C15H29N5O3S — CID 111592737
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(ethylsulfonylamino)ethyl]guanidine (PubChem CID 111592737) has the molecular formula C15H29N5O3S and a molecular weight of 359.50 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(ethylsulfonylamino)ethyl]guanidine.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(ethylsulfonylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 111592737 |
| Molecular Formula | C15H29N5O3S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(ethylsulfonylamino)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCCNS(=O)(=O)CC |
| InChI | InChI=1S/C15H29N5O3S/c1-6-16-14(17-8-9-20-24(21,22)7-2)19-11-13-18-10-12(23-13)15(3,4)5/h10,20H,6-9,11H2,1-5H3,(H2,16,17,19) |
| InChIKey | RWKKILCXXRIWTF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|