C18H30IN5OS — CID 111592702
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111592702) has the molecular formula C18H30IN5OS and a molecular weight of 491.44 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111592702 |
| Molecular Formula | C18H30IN5OS |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCCc1csc(CC)n1.I |
| InChI | InChI=1S/C18H29N5OS.HI/c1-6-16-23-13(12-25-16)8-9-20-17(19-7-2)22-11-15-21-10-14(24-15)18(3,4)5;/h10,12H,6-9,11H2,1-5H3,(H2,19,20,22);1H |
| InChIKey | WJTDWQJWPZWOPJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|