C20H27F3N4O — CID 111592869
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111592869) has the molecular formula C20H27F3N4O and a molecular weight of 396.46 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111592869 |
| Molecular Formula | C20H27F3N4O |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H27F3N4O/c1-5-24-18(27-13-17-26-12-16(28-17)19(2,3)4)25-11-10-14-6-8-15(9-7-14)20(21,22)23/h6-9,12H,5,10-11,13H2,1-4H3,(H2,24,25,27) |
| InChIKey | IWQPWGSCQYXDKM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|