C18H31N5O3 — CID 111712777
1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[2-(2-nitroanilino)ethyl]guanidine (PubChem CID 111712777) has the molecular formula C18H31N5O3 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[2-(2-nitroanilino)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[2-(2-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 111712777 |
| Molecular Formula | C18H31N5O3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[2-(2-nitroanilino)ethyl]guanidine |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H31N5O3/c1-3-7-15(10-13-24)14-22-18(19-4-2)21-12-11-20-16-8-5-6-9-17(16)23(25)26/h5-6,8-9,15,20,24H,3-4,7,10-14H2,1-2H3,(H2,19,21,22) |
| InChIKey | RJJWPTSUIURJDA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|