C14H19N5O2 — CID 136922113
1-ethyl-2-[2-(2-nitroanilino)ethyl]-3-prop-2-ynylguanidine (PubChem CID 136922113) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-nitroanilino)ethyl]-3-prop-2-ynylguanidine.
| Compound Name | 1-ethyl-2-[2-(2-nitroanilino)ethyl]-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 136922113 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-ethyl-2-[2-(2-nitroanilino)ethyl]-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/CCNc1ccccc1[N+](=O)[O-])NCC |
| InChI | InChI=1S/C14H19N5O2/c1-3-9-17-14(15-4-2)18-11-10-16-12-7-5-6-8-13(12)19(20)21/h1,5-8,16H,4,9-11H2,2H3,(H2,15,17,18) |
| InChIKey | LBXUUKNZJGBGKV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|