C15H19N5S — CID 136922173
2-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-ethyl-3-prop-2-ynylguanidine (PubChem CID 136922173) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-ethyl-3-prop-2-ynylguanidine.
| Compound Name | 2-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-ethyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 136922173 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-ethyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/CCNc1nc2ccccc2s1)NCC |
| InChI | InChI=1S/C15H19N5S/c1-3-9-17-14(16-4-2)18-10-11-19-15-20-12-7-5-6-8-13(12)21-15/h1,5-8H,4,9-11H2,2H3,(H,19,20)(H2,16,17,18) |
| InChIKey | UHZXXVOYUFFXKY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|