C18H29N5O4 — CID 111407863
2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111407863) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111407863 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H29N5O4/c1-19-18(21-9-5-12-26-14-15-6-4-13-27-15)22-11-10-20-16-7-2-3-8-17(16)23(24)25/h2-3,7-8,15,20H,4-6,9-14H2,1H3,(H2,19,21,22) |
| InChIKey | KTBHAJMEBIAGIF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|