C17H20N2O3S — CID 95317070
4-[[(2S)-oxolan-2-yl]methoxy]-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide (PubChem CID 95317070) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 4-[[(2S)-oxolan-2-yl]methoxy]-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide.
| Compound Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 95317070 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1cscn1)c1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c20-17(18-8-7-14-11-23-12-19-14)13-3-5-15(6-4-13)22-10-16-2-1-9-21-16/h3-6,11-12,16H,1-2,7-10H2,(H,18,20)/t16-/m0/s1 |
| InChIKey | MSDRWSZPQMXKBJ-INIZCTEOSA-N |
| XLogP | 2.67 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |