C16H19N3O3 — CID 91641650
4-(oxolan-2-ylmethoxy)-N-(1H-pyrazol-5-ylmethyl)benzamide (PubChem CID 91641650) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethoxy)-N-(1H-pyrazol-5-ylmethyl)benzamide.
| Compound Name | 4-(oxolan-2-ylmethoxy)-N-(1H-pyrazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 91641650 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-(oxolan-2-ylmethoxy)-N-(1H-pyrazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccn[nH]1)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c20-16(17-10-13-7-8-18-19-13)12-3-5-14(6-4-12)22-11-15-2-1-9-21-15/h3-8,15H,1-2,9-11H2,(H,17,20)(H,18,19) |
| InChIKey | LWGDEOQIXACBDB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |