C13H18Cl2N4O2 — CID 51957641
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 51957641) has the molecular formula C13H18Cl2N4O2 and a molecular weight of 333.22 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 51957641 |
| Molecular Formula | C13H18Cl2N4O2 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NCCNc1ncc(Cl)cc1Cl)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C13H18Cl2N4O2/c14-9-6-11(15)12(18-7-9)16-3-4-17-13(20)19-8-10-2-1-5-21-10/h6-7,10H,1-5,8H2,(H,16,18)(H2,17,19,20)/t10-/m1/s1 |
| InChIKey | LCJDFHDITAKVRF-SNVBAGLBSA-N |
| XLogP | 2.28 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|