C14H22Cl2N4O2 — CID 111120991
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(2-hydroxy-2,3-dimethylbutyl)urea (PubChem CID 111120991) has the molecular formula C14H22Cl2N4O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(2-hydroxy-2,3-dimethylbutyl)urea.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(2-hydroxy-2,3-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111120991 |
| Molecular Formula | C14H22Cl2N4O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(2-hydroxy-2,3-dimethylbutyl)urea |
| SMILES | CC(C)C(C)(O)CNC(=O)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C14H22Cl2N4O2/c1-9(2)14(3,22)8-20-13(21)18-5-4-17-12-11(16)6-10(15)7-19-12/h6-7,9,22H,4-5,8H2,1-3H3,(H,17,19)(H2,18,20,21) |
| InChIKey | YMEJSDZGUKALPQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|