C16H24Cl2N4O — CID 119853841
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-piperidin-3-ylbutanamide (PubChem CID 119853841) has the molecular formula C16H24Cl2N4O and a molecular weight of 359.30 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119853841 |
| Molecular Formula | C16H24Cl2N4O |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)NCCNc1ncc(Cl)cc1Cl)C1CCCNC1 |
| InChI | InChI=1S/C16H24Cl2N4O/c1-11(12-3-2-4-19-9-12)7-15(23)20-5-6-21-16-14(18)8-13(17)10-22-16/h8,10-12,19H,2-7,9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | CARKZNTWOHMCPN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|