C17H26N4O3 — CID 119692379
N-[2-(2-nitroanilino)ethyl]-3-piperidin-3-ylbutanamide (PubChem CID 119692379) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(2-nitroanilino)ethyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[2-(2-nitroanilino)ethyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119692379 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[2-(2-nitroanilino)ethyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)NCCNc1ccccc1[N+](=O)[O-])C1CCCNC1 |
| InChI | InChI=1S/C17H26N4O3/c1-13(14-5-4-8-18-12-14)11-17(22)20-10-9-19-15-6-2-3-7-16(15)21(23)24/h2-3,6-7,13-14,18-19H,4-5,8-12H2,1H3,(H,20,22) |
| InChIKey | PCCDKIORHCRZBZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|