C24H32N2O — CID 119675917
N-(3,3-diphenylpropyl)-3-piperidin-3-ylbutanamide (PubChem CID 119675917) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-3-piperidin-3-ylbutanamide.
| Compound Name | N-(3,3-diphenylpropyl)-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119675917 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N-(3,3-diphenylpropyl)-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)NCCC(c1ccccc1)c1ccccc1)C1CCCNC1 |
| InChI | InChI=1S/C24H32N2O/c1-19(22-13-8-15-25-18-22)17-24(27)26-16-14-23(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,19,22-23,25H,8,13-18H2,1H3,(H,26,27) |
| InChIKey | KDPFFKQQCLJYDU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |