C19H26ClN3O3 — CID 119741122
N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119741122) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119741122 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCN1C(=O)c2ccccc2C1=O)C1CCCNC1.Cl |
| InChI | InChI=1S/C19H25N3O3.ClH/c1-13(14-5-4-8-20-12-14)11-17(23)21-9-10-22-18(24)15-6-2-3-7-16(15)19(22)25;/h2-3,6-7,13-14,20H,4-5,8-12H2,1H3,(H,21,23);1H |
| InChIKey | UOZKAOWTVPBFTB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|