C23H25N3O3 — CID 119773965
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-piperidin-3-ylbutanamide (PubChem CID 119773965) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119773965 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)Nc1cccc(N2C(=O)c3ccccc3C2=O)c1)C1CCCNC1 |
| InChI | InChI=1S/C23H25N3O3/c1-15(16-6-5-11-24-14-16)12-21(27)25-17-7-4-8-18(13-17)26-22(28)19-9-2-3-10-20(19)23(26)29/h2-4,7-10,13,15-16,24H,5-6,11-12,14H2,1H3,(H,25,27) |
| InChIKey | UXVXWCFOYZOYTI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|