C15H28Cl2N4O — CID 119869277
N-[2-(2-methylimidazol-1-yl)ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119869277) has the molecular formula C15H28Cl2N4O and a molecular weight of 351.32 g/mol. Its IUPAC name is N-[2-(2-methylimidazol-1-yl)ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[2-(2-methylimidazol-1-yl)ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119869277 |
| Molecular Formula | C15H28Cl2N4O |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[2-(2-methylimidazol-1-yl)ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | Cc1nccn1CCNC(=O)CC(C)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C15H26N4O.2ClH/c1-12(14-4-3-5-16-11-14)10-15(20)18-7-9-19-8-6-17-13(19)2;;/h6,8,12,14,16H,3-5,7,9-11H2,1-2H3,(H,18,20);2*1H |
| InChIKey | LMNQHFCJNULLBC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |