C14H20ClN3O2S — CID 97262264
1-[2-[(2-chloro-4-pyridinyl)methylsulfanyl]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 97262264) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is 1-[2-[(2-chloro-4-pyridinyl)methylsulfanyl]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[2-[(2-chloro-4-pyridinyl)methylsulfanyl]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97262264 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-[2-[(2-chloro-4-pyridinyl)methylsulfanyl]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NCCSCc1ccnc(Cl)c1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C14H20ClN3O2S/c15-13-8-11(3-4-16-13)10-21-7-5-17-14(19)18-9-12-2-1-6-20-12/h3-4,8,12H,1-2,5-7,9-10H2,(H2,17,18,19)/t12-/m1/s1 |
| InChIKey | LFKLZCXRMQZXQR-GFCCVEGCSA-N |
| XLogP | 2.45 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|