C11H14ClNO3S — CID 122135921
2-chloro-4-(oxolan-2-ylmethylsulfonylmethyl)pyridine (PubChem CID 122135921) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is 2-chloro-4-(oxolan-2-ylmethylsulfonylmethyl)pyridine.
| Compound Name | 2-chloro-4-(oxolan-2-ylmethylsulfonylmethyl)pyridine |
|---|---|
| PubChem CID | 122135921 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-chloro-4-(oxolan-2-ylmethylsulfonylmethyl)pyridine |
| SMILES | O=S(=O)(Cc1ccnc(Cl)c1)CC1CCCO1 |
| InChI | InChI=1S/C11H14ClNO3S/c12-11-6-9(3-4-13-11)7-17(14,15)8-10-2-1-5-16-10/h3-4,6,10H,1-2,5,7-8H2 |
| InChIKey | BSGOQEXGGOPNTE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|