C11H14O6S — CID 106493679
2-(oxolan-2-ylmethylsulfonylmethyl)furan-3-carboxylic acid (PubChem CID 106493679) has the molecular formula C11H14O6S and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfonylmethyl)furan-3-carboxylic acid.
| Compound Name | 2-(oxolan-2-ylmethylsulfonylmethyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 106493679 |
| Molecular Formula | C11H14O6S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfonylmethyl)furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1CS(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C11H14O6S/c12-11(13)9-3-5-17-10(9)7-18(14,15)6-8-2-1-4-16-8/h3,5,8H,1-2,4,6-7H2,(H,12,13) |
| InChIKey | SQIAHJCWTNFJFE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |