C14H23NO4S — CID 106495988
N-[[5-(oxolan-2-ylmethylsulfonylmethyl)furan-2-yl]methyl]propan-2-amine (PubChem CID 106495988) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[[5-(oxolan-2-ylmethylsulfonylmethyl)furan-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(oxolan-2-ylmethylsulfonylmethyl)furan-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 106495988 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[[5-(oxolan-2-ylmethylsulfonylmethyl)furan-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(CS(=O)(=O)CC2CCCO2)o1 |
| InChI | InChI=1S/C14H23NO4S/c1-11(2)15-8-12-5-6-14(19-12)10-20(16,17)9-13-4-3-7-18-13/h5-6,11,13,15H,3-4,7-10H2,1-2H3 |
| InChIKey | DVPZIXBVJRFIAL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |