C14H17BrO5S — CID 106493670
methyl 3-bromo-4-(oxolan-2-ylmethylsulfonylmethyl)benzoate (PubChem CID 106493670) has the molecular formula C14H17BrO5S and a molecular weight of 377.26 g/mol. Its IUPAC name is methyl 3-bromo-4-(oxolan-2-ylmethylsulfonylmethyl)benzoate.
| Compound Name | methyl 3-bromo-4-(oxolan-2-ylmethylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 106493670 |
| Molecular Formula | C14H17BrO5S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | methyl 3-bromo-4-(oxolan-2-ylmethylsulfonylmethyl)benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)CC2CCCO2)c(Br)c1 |
| InChI | InChI=1S/C14H17BrO5S/c1-19-14(16)10-4-5-11(13(15)7-10)8-21(17,18)9-12-3-2-6-20-12/h4-5,7,12H,2-3,6,8-9H2,1H3 |
| InChIKey | WUTAIDUDXOFFTG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |