C13H15BrO4S — CID 106497076
1-(2-bromophenyl)-2-(oxolan-2-ylmethylsulfonyl)ethanone (PubChem CID 106497076) has the molecular formula C13H15BrO4S and a molecular weight of 347.23 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2-(oxolan-2-ylmethylsulfonyl)ethanone.
| Compound Name | 1-(2-bromophenyl)-2-(oxolan-2-ylmethylsulfonyl)ethanone |
|---|---|
| PubChem CID | 106497076 |
| Molecular Formula | C13H15BrO4S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 1-(2-bromophenyl)-2-(oxolan-2-ylmethylsulfonyl)ethanone |
| SMILES | O=C(CS(=O)(=O)CC1CCCO1)c1ccccc1Br |
| InChI | InChI=1S/C13H15BrO4S/c14-12-6-2-1-5-11(12)13(15)9-19(16,17)8-10-4-3-7-18-10/h1-2,5-6,10H,3-4,7-9H2 |
| InChIKey | ZTZWZVIXJYWWQM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |