C14H19BrO3S — CID 99820888
(2R)-2-[3-(2-bromophenyl)propylsulfonylmethyl]oxolane (PubChem CID 99820888) has the molecular formula C14H19BrO3S and a molecular weight of 347.27 g/mol. Its IUPAC name is (2R)-2-[3-(2-bromophenyl)propylsulfonylmethyl]oxolane.
| Compound Name | (2R)-2-[3-(2-bromophenyl)propylsulfonylmethyl]oxolane |
|---|---|
| PubChem CID | 99820888 |
| Molecular Formula | C14H19BrO3S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | (2R)-2-[3-(2-bromophenyl)propylsulfonylmethyl]oxolane |
| SMILES | O=S(=O)(CCCc1ccccc1Br)C[C@H]1CCCO1 |
| InChI | InChI=1S/C14H19BrO3S/c15-14-8-2-1-5-12(14)6-4-10-19(16,17)11-13-7-3-9-18-13/h1-2,5,8,13H,3-4,6-7,9-11H2/t13-/m1/s1 |
| InChIKey | VAUDOOHKZPMNEI-CYBMUJFWSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |