C14H18BrClO — CID 66049471
2-[2-[(2-bromophenyl)methyl]-3-chloropropyl]oxolane (PubChem CID 66049471) has the molecular formula C14H18BrClO and a molecular weight of 317.65 g/mol. Its IUPAC name is 2-[2-[(2-bromophenyl)methyl]-3-chloropropyl]oxolane.
| Compound Name | 2-[2-[(2-bromophenyl)methyl]-3-chloropropyl]oxolane |
|---|---|
| PubChem CID | 66049471 |
| Molecular Formula | C14H18BrClO |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-[2-[(2-bromophenyl)methyl]-3-chloropropyl]oxolane |
| SMILES | ClCC(Cc1ccccc1Br)CC1CCCO1 |
| InChI | InChI=1S/C14H18BrClO/c15-14-6-2-1-4-12(14)8-11(10-16)9-13-5-3-7-17-13/h1-2,4,6,11,13H,3,5,7-10H2 |
| InChIKey | NMXDIZRGPZCENC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|