C15H21BrO2 — CID 103142494
2-[(2-bromophenyl)methyl]-3-(5-methyloxolan-2-yl)propan-1-ol (PubChem CID 103142494) has the molecular formula C15H21BrO2 and a molecular weight of 313.23 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]-3-(5-methyloxolan-2-yl)propan-1-ol.
| Compound Name | 2-[(2-bromophenyl)methyl]-3-(5-methyloxolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 103142494 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]-3-(5-methyloxolan-2-yl)propan-1-ol |
| SMILES | CC1CCC(CC(CO)Cc2ccccc2Br)O1 |
| InChI | InChI=1S/C15H21BrO2/c1-11-6-7-14(18-11)9-12(10-17)8-13-4-2-3-5-15(13)16/h2-5,11-12,14,17H,6-10H2,1H3 |
| InChIKey | DTWURIAGSMPNNW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |