C17H24BrNO2 — CID 100634985
N-[(2S)-2-[(2-bromophenyl)methyl]-3-hydroxypropyl]cyclohexanecarboxamide (PubChem CID 100634985) has the molecular formula C17H24BrNO2 and a molecular weight of 354.29 g/mol. Its IUPAC name is N-[(2S)-2-[(2-bromophenyl)methyl]-3-hydroxypropyl]cyclohexanecarboxamide.
| Compound Name | N-[(2S)-2-[(2-bromophenyl)methyl]-3-hydroxypropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 100634985 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[(2S)-2-[(2-bromophenyl)methyl]-3-hydroxypropyl]cyclohexanecarboxamide |
| SMILES | O=C(NC[C@@H](CO)Cc1ccccc1Br)C1CCCCC1 |
| InChI | InChI=1S/C17H24BrNO2/c18-16-9-5-4-8-15(16)10-13(12-20)11-19-17(21)14-6-2-1-3-7-14/h4-5,8-9,13-14,20H,1-3,6-7,10-12H2,(H,19,21)/t13-/m0/s1 |
| InChIKey | DRQRFXCVOLGISD-ZDUSSCGKSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |