C16H22O4S — CID 106497039
2-(oxolan-2-ylmethylsulfonyl)-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 106497039) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfonyl)-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-(oxolan-2-ylmethylsulfonyl)-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 106497039 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfonyl)-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)CS(=O)(=O)CC2CCCO2)c(C)c1 |
| InChI | InChI=1S/C16H22O4S/c1-11-7-12(2)16(13(3)8-11)15(17)10-21(18,19)9-14-5-4-6-20-14/h7-8,14H,4-6,9-10H2,1-3H3 |
| InChIKey | CTXQIKJHVSUCAK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |