C13H18ClN3O3S2 — CID 97347771
1-[2-[(2-chloro-4-pyridinyl)methylsulfanyl]ethyl]-3-[(3R)-1,1-dioxothiolan-3-yl]urea (PubChem CID 97347771) has the molecular formula C13H18ClN3O3S2 and a molecular weight of 363.89 g/mol. Its IUPAC name is 1-[2-[(2-chloro-4-pyridinyl)methylsulfanyl]ethyl]-3-[(3R)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-[2-[(2-chloro-4-pyridinyl)methylsulfanyl]ethyl]-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 97347771 |
| Molecular Formula | C13H18ClN3O3S2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 1-[2-[(2-chloro-4-pyridinyl)methylsulfanyl]ethyl]-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
| SMILES | O=C(NCCSCc1ccnc(Cl)c1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18ClN3O3S2/c14-12-7-10(1-3-15-12)8-21-5-4-16-13(18)17-11-2-6-22(19,20)9-11/h1,3,7,11H,2,4-6,8-9H2,(H2,16,17,18)/t11-/m1/s1 |
| InChIKey | GAWQBLJMHHXEAT-LLVKDONJSA-N |
| XLogP | 1.45 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|