C15H24ClN3O2S — CID 154908659
1-(2-benzylsulfanylethyl)-3-(morpholin-2-ylmethyl)urea;hydrochloride (PubChem CID 154908659) has the molecular formula C15H24ClN3O2S and a molecular weight of 345.90 g/mol. Its IUPAC name is 1-(2-benzylsulfanylethyl)-3-(morpholin-2-ylmethyl)urea;hydrochloride.
| Compound Name | 1-(2-benzylsulfanylethyl)-3-(morpholin-2-ylmethyl)urea;hydrochloride |
|---|---|
| PubChem CID | 154908659 |
| Molecular Formula | C15H24ClN3O2S |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-(2-benzylsulfanylethyl)-3-(morpholin-2-ylmethyl)urea;hydrochloride |
| SMILES | Cl.O=C(NCCSCc1ccccc1)NCC1CNCCO1 |
| InChI | InChI=1S/C15H23N3O2S.ClH/c19-15(18-11-14-10-16-6-8-20-14)17-7-9-21-12-13-4-2-1-3-5-13;/h1-5,14,16H,6-12H2,(H2,17,18,19);1H |
| InChIKey | XPNFJHLSBJPQLV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|