C17H24N2O3S — CID 125174342
N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-3-benzylsulfanylpropanamide (PubChem CID 125174342) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-3-benzylsulfanylpropanamide.
| Compound Name | N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-3-benzylsulfanylpropanamide |
|---|---|
| PubChem CID | 125174342 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[[(2R)-4-acetylmorpholin-2-yl]methyl]-3-benzylsulfanylpropanamide |
| SMILES | CC(=O)N1CCO[C@H](CNC(=O)CCSCc2ccccc2)C1 |
| InChI | InChI=1S/C17H24N2O3S/c1-14(20)19-8-9-22-16(12-19)11-18-17(21)7-10-23-13-15-5-3-2-4-6-15/h2-6,16H,7-13H2,1H3,(H,18,21)/t16-/m1/s1 |
| InChIKey | CSFUYYRANGTQEI-MRXNPFEDSA-N |
| XLogP | 1.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|