C17H24N3O3S — CID 59866910
CID 59866910 (PubChem CID 59866910) has the molecular formula C17H24N3O3S and a molecular weight of 350.46 g/mol.
| Compound Name | CID 59866910 |
|---|---|
| PubChem CID | 59866910 |
| Molecular Formula | C17H24N3O3S |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | — |
| SMILES | NC(=O)[CH]CSCC(=O)NCC1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C17H24N3O3S/c18-16(21)6-9-24-13-17(22)19-10-15-12-20(7-8-23-15)11-14-4-2-1-3-5-14/h1-6,15H,7-13H2,(H2,18,21)(H,19,22) |
| InChIKey | XEWOYXDEBDWJBC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|