C16H26Cl2N4O3 — CID 119957852
2-amino-N-[(4-benzylmorpholin-2-yl)methyl]butanediamide;dihydrochloride (PubChem CID 119957852) has the molecular formula C16H26Cl2N4O3 and a molecular weight of 393.32 g/mol. Its IUPAC name is 2-amino-N-[(4-benzylmorpholin-2-yl)methyl]butanediamide;dihydrochloride.
| Compound Name | 2-amino-N-[(4-benzylmorpholin-2-yl)methyl]butanediamide;dihydrochloride |
|---|---|
| PubChem CID | 119957852 |
| Molecular Formula | C16H26Cl2N4O3 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-amino-N-[(4-benzylmorpholin-2-yl)methyl]butanediamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)CC(N)C(=O)NCC1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C16H24N4O3.2ClH/c17-14(8-15(18)21)16(22)19-9-13-11-20(6-7-23-13)10-12-4-2-1-3-5-12;;/h1-5,13-14H,6-11,17H2,(H2,18,21)(H,19,22);2*1H |
| InChIKey | OAJQELAESXKSJS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |