C26H28N2O2S — CID 43008733
N-[(4-benzylmorpholin-2-yl)methyl]-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 43008733) has the molecular formula C26H28N2O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is N-[(4-benzylmorpholin-2-yl)methyl]-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-[(4-benzylmorpholin-2-yl)methyl]-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 43008733 |
| Molecular Formula | C26H28N2O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-[(4-benzylmorpholin-2-yl)methyl]-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(NCC1CN(Cc2ccccc2)CCO1)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O2S/c29-26(25(22-12-6-2-7-13-22)31-24-14-8-3-9-15-24)27-18-23-20-28(16-17-30-23)19-21-10-4-1-5-11-21/h1-15,23,25H,16-20H2,(H,27,29) |
| InChIKey | WTORCTKEEVENTQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |