C13H20N2OS — CID 94870511
1-(2-benzylsulfanylethyl)-3-propylurea (PubChem CID 94870511) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-(2-benzylsulfanylethyl)-3-propylurea.
| Compound Name | 1-(2-benzylsulfanylethyl)-3-propylurea |
|---|---|
| PubChem CID | 94870511 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-(2-benzylsulfanylethyl)-3-propylurea |
| SMILES | CCCNC(=O)NCCSCc1ccccc1 |
| InChI | InChI=1S/C13H20N2OS/c1-2-8-14-13(16)15-9-10-17-11-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H2,14,15,16) |
| InChIKey | CKKGJIVHOYDDBI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|