C15H20F2N2O3 — CID 95759878
1-[2-(3,4-difluorophenoxy)ethyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea (PubChem CID 95759878) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 95759878 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]urea |
| SMILES | C[C@H](NC(=O)NCCOc1ccc(F)c(F)c1)[C@H]1CCCO1 |
| InChI | InChI=1S/C15H20F2N2O3/c1-10(14-3-2-7-22-14)19-15(20)18-6-8-21-11-4-5-12(16)13(17)9-11/h4-5,9-10,14H,2-3,6-8H2,1H3,(H2,18,19,20)/t10-,14+/m0/s1 |
| InChIKey | ANUSMNGBZXHFBM-IINYFYTJSA-N |
| XLogP | 2.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|