C18H24F2N2O3 — CID 127996993
N-[2-(3,4-difluorophenoxy)ethyl]-4-(oxolan-2-yl)piperidine-1-carboxamide (PubChem CID 127996993) has the molecular formula C18H24F2N2O3 and a molecular weight of 354.40 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenoxy)ethyl]-4-(oxolan-2-yl)piperidine-1-carboxamide.
| Compound Name | N-[2-(3,4-difluorophenoxy)ethyl]-4-(oxolan-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 127996993 |
| Molecular Formula | C18H24F2N2O3 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-[2-(3,4-difluorophenoxy)ethyl]-4-(oxolan-2-yl)piperidine-1-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)c(F)c1)N1CCC(C2CCCO2)CC1 |
| InChI | InChI=1S/C18H24F2N2O3/c19-15-4-3-14(12-16(15)20)24-11-7-21-18(23)22-8-5-13(6-9-22)17-2-1-10-25-17/h3-4,12-13,17H,1-2,5-11H2,(H,21,23) |
| InChIKey | WCTQVMRTCFTSHE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|