C9H11Cl3N2 — CID 65027406
3,5-dichloro-N-(1-chloro-2-methylpropan-2-yl)pyridin-2-amine (PubChem CID 65027406) has the molecular formula C9H11Cl3N2 and a molecular weight of 253.56 g/mol. Its IUPAC name is 3,5-dichloro-N-(1-chloro-2-methylpropan-2-yl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-(1-chloro-2-methylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 65027406 |
| Molecular Formula | C9H11Cl3N2 |
| Molecular Weight | 253.56 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 3,5-dichloro-N-(1-chloro-2-methylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(C)(CCl)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl3N2/c1-9(2,5-10)14-8-7(12)3-6(11)4-13-8/h3-4H,5H2,1-2H3,(H,13,14) |
| InChIKey | PPSZKRQXFHLXER-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|