C9H10BrCl3N2 — CID 103584161
5-bromo-3-chloro-N-(1,3-dichloro-2-methylpropan-2-yl)pyridin-2-amine (PubChem CID 103584161) has the molecular formula C9H10BrCl3N2 and a molecular weight of 332.46 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-(1,3-dichloro-2-methylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-(1,3-dichloro-2-methylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 103584161 |
| Molecular Formula | C9H10BrCl3N2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 329.91 |
| IUPAC Name | 5-bromo-3-chloro-N-(1,3-dichloro-2-methylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(CCl)(CCl)Nc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C9H10BrCl3N2/c1-9(4-11,5-12)15-8-7(13)2-6(10)3-14-8/h2-3H,4-5H2,1H3,(H,14,15) |
| InChIKey | ZCPVGMFLIDSBJQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|