C8H9BrCl2N2 — CID 103584101
5-bromo-3-chloro-N-(1-chloropropan-2-yl)pyridin-2-amine (PubChem CID 103584101) has the molecular formula C8H9BrCl2N2 and a molecular weight of 283.98 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-(1-chloropropan-2-yl)pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-(1-chloropropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 103584101 |
| Molecular Formula | C8H9BrCl2N2 |
| Molecular Weight | 283.98 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | 5-bromo-3-chloro-N-(1-chloropropan-2-yl)pyridin-2-amine |
| SMILES | CC(CCl)Nc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C8H9BrCl2N2/c1-5(3-10)13-8-7(11)2-6(9)4-12-8/h2,4-5H,3H2,1H3,(H,12,13) |
| InChIKey | HELXOLXWOUAWAG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.98 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|