C12H12BrClN2S — CID 103582447
5-bromo-3-chloro-N-(1-thiophen-3-ylpropan-2-yl)pyridin-2-amine (PubChem CID 103582447) has the molecular formula C12H12BrClN2S and a molecular weight of 331.67 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-(1-thiophen-3-ylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-(1-thiophen-3-ylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 103582447 |
| Molecular Formula | C12H12BrClN2S |
| Molecular Weight | 331.67 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 5-bromo-3-chloro-N-(1-thiophen-3-ylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(Cc1ccsc1)Nc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C12H12BrClN2S/c1-8(4-9-2-3-17-7-9)16-12-11(14)5-10(13)6-15-12/h2-3,5-8H,4H2,1H3,(H,15,16) |
| InChIKey | REPSELBCFGDJGQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |