C10H14BrClN2S — CID 103582641
5-bromo-3-chloro-N-(1-ethylsulfanylpropan-2-yl)pyridin-2-amine (PubChem CID 103582641) has the molecular formula C10H14BrClN2S and a molecular weight of 309.66 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-(1-ethylsulfanylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-(1-ethylsulfanylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 103582641 |
| Molecular Formula | C10H14BrClN2S |
| Molecular Weight | 309.66 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 5-bromo-3-chloro-N-(1-ethylsulfanylpropan-2-yl)pyridin-2-amine |
| SMILES | CCSCC(C)Nc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C10H14BrClN2S/c1-3-15-6-7(2)14-10-9(12)4-8(11)5-13-10/h4-5,7H,3,6H2,1-2H3,(H,13,14) |
| InChIKey | KFPDNOFGLPXICA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |