C12H18BrClN2O — CID 103580433
5-bromo-3-chloro-N-(1-ethoxy-3-methylbutan-2-yl)pyridin-2-amine (PubChem CID 103580433) has the molecular formula C12H18BrClN2O and a molecular weight of 321.65 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-(1-ethoxy-3-methylbutan-2-yl)pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-(1-ethoxy-3-methylbutan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 103580433 |
| Molecular Formula | C12H18BrClN2O |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 5-bromo-3-chloro-N-(1-ethoxy-3-methylbutan-2-yl)pyridin-2-amine |
| SMILES | CCOCC(Nc1ncc(Br)cc1Cl)C(C)C |
| InChI | InChI=1S/C12H18BrClN2O/c1-4-17-7-11(8(2)3)16-12-10(14)5-9(13)6-15-12/h5-6,8,11H,4,7H2,1-3H3,(H,15,16) |
| InChIKey | UEUDIZKTSHGHSD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |