C11H19ClN4 — CID 106251840
N'-(5-chloropyrimidin-2-yl)-2,2-diethylpropane-1,3-diamine (PubChem CID 106251840) has the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. Its IUPAC name is N'-(5-chloropyrimidin-2-yl)-2,2-diethylpropane-1,3-diamine.
| Compound Name | N'-(5-chloropyrimidin-2-yl)-2,2-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106251840 |
| Molecular Formula | C11H19ClN4 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N'-(5-chloropyrimidin-2-yl)-2,2-diethylpropane-1,3-diamine |
| SMILES | CCC(CC)(CN)CNc1ncc(Cl)cn1 |
| InChI | InChI=1S/C11H19ClN4/c1-3-11(4-2,7-13)8-16-10-14-5-9(12)6-15-10/h5-6H,3-4,7-8,13H2,1-2H3,(H,14,15,16) |
| InChIKey | GPMANKCJHXBADI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |