C11H13Cl2F3N2 — CID 107867364
N-[1-chloro-2-(chloromethyl)butan-2-yl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 107867364) has the molecular formula C11H13Cl2F3N2 and a molecular weight of 301.14 g/mol. Its IUPAC name is N-[1-chloro-2-(chloromethyl)butan-2-yl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107867364 |
| Molecular Formula | C11H13Cl2F3N2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCC(CCl)(CCl)Nc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C11H13Cl2F3N2/c1-2-10(6-12,7-13)18-9-8(11(14,15)16)4-3-5-17-9/h3-5H,2,6-7H2,1H3,(H,17,18) |
| InChIKey | RNPILSCXCPTBAP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|