C8H7Cl3N2O — CID 4583439
2-chloro-N-(3,5-dichloro-2-pyridinyl)propanamide (PubChem CID 4583439) has the molecular formula C8H7Cl3N2O and a molecular weight of 253.52 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichloro-2-pyridinyl)propanamide.
| Compound Name | 2-chloro-N-(3,5-dichloro-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 4583439 |
| Molecular Formula | C8H7Cl3N2O |
| Molecular Weight | 253.52 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | 2-chloro-N-(3,5-dichloro-2-pyridinyl)propanamide |
| SMILES | CC(Cl)C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl3N2O/c1-4(9)8(14)13-7-6(11)2-5(10)3-12-7/h2-4H,1H3,(H,12,13,14) |
| InChIKey | LNSJNKMEAJUSBK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|