About N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide
N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide (PubChem CID 2353143) has the molecular formula C14H12Cl2N2O2S
and a molecular weight of 343.24 g/mol. Its IUPAC name is N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide.
Molecular Properties
| Compound Name | N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide |
| PubChem CID | 2353143 |
| Molecular Formula | C14H12Cl2N2O2S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide |
| SMILES | COc1cc(SC)ccc1C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O2S/c1-20-12-6-9(21-2)3-4-10(12)14(19)18-13-11(16)5-8(15)7-17-13/h3-7H,1-2H3,(H,17,18,19) |
| InChIKey | WSHNWWOIVODKOD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide?
The IUPAC name of N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide (CID 2353143) is N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide.
What is the SMILES notation for N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide?
The canonical SMILES for N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide is COc1cc(SC)ccc1C(=O)Nc1ncc(Cl)cc1Cl.
What is the InChIKey of N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide?
The InChIKey is WSHNWWOIVODKOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N2O2S/c1-20-12-6-9(21-2)3-4-10(12)14(19)18-13-11(16)5-8(15)7-17-13/h3-7H,1-2H3,(H,17,18,19).
What are the key properties of N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide?
N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide has a molecular weight of 343.24 g/mol, XLogP of 4.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichloro-2-pyridinyl)-2-methoxy-4-methylsulfanylbenzamide is sourced from PubChem (CID 2353143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).