C16H14N2O2S2 — CID 3512534
N-(1,3-benzothiazol-2-yl)-2-methoxy-4-methylsulfanylbenzamide (PubChem CID 3512534) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-methoxy-4-methylsulfanylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-methoxy-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 3512534 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-methoxy-4-methylsulfanylbenzamide |
| SMILES | COc1cc(SC)ccc1C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-20-13-9-10(21-2)7-8-11(13)15(19)18-16-17-12-5-3-4-6-14(12)22-16/h3-9H,1-2H3,(H,17,18,19) |
| InChIKey | ZFACZOOCYYWICF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |