C16H14Cl2N2O5 — CID 3527089
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2,4-dimethoxybenzoate (PubChem CID 3527089) has the molecular formula C16H14Cl2N2O5 and a molecular weight of 385.20 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2,4-dimethoxybenzoate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 3527089 |
| Molecular Formula | C16H14Cl2N2O5 |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ncc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C16H14Cl2N2O5/c1-23-10-3-4-11(13(6-10)24-2)16(22)25-8-14(21)20-15-12(18)5-9(17)7-19-15/h3-7H,8H2,1-2H3,(H,19,20,21) |
| InChIKey | QDBLJCVCMVGIGM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |