C21H16Cl2N2O4 — CID 4184238
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylmethoxybenzoate (PubChem CID 4184238) has the molecular formula C21H16Cl2N2O4 and a molecular weight of 431.28 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylmethoxybenzoate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 4184238 |
| Molecular Formula | C21H16Cl2N2O4 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-phenylmethoxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1OCc1ccccc1)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N2O4/c22-15-10-17(23)20(24-11-15)25-19(26)13-29-21(27)16-8-4-5-9-18(16)28-12-14-6-2-1-3-7-14/h1-11H,12-13H2,(H,24,25,26) |
| InChIKey | ZRSJDJIJNULHPZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |